C17H22N2O4S2 — CID 18711665
S-cyclopentyl N-[3-methyl-3-(4-nitrophenyl)sulfanyl-1-oxobutan-2-yl]carbamothioate (PubChem CID 18711665) has the molecular formula C17H22N2O4S2 and a molecular weight of 382.51 g/mol. Its IUPAC name is S-cyclopentyl N-[3-methyl-3-(4-nitrophenyl)sulfanyl-1-oxobutan-2-yl]carbamothioate.
| Compound Name | S-cyclopentyl N-[3-methyl-3-(4-nitrophenyl)sulfanyl-1-oxobutan-2-yl]carbamothioate |
|---|---|
| PubChem CID | 18711665 |
| Molecular Formula | C17H22N2O4S2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | S-cyclopentyl N-[3-methyl-3-(4-nitrophenyl)sulfanyl-1-oxobutan-2-yl]carbamothioate |
| SMILES | CC(C)(Sc1ccc([N+](=O)[O-])cc1)C(C=O)NC(=O)SC1CCCC1 |
| InChI | InChI=1S/C17H22N2O4S2/c1-17(2,25-14-9-7-12(8-10-14)19(22)23)15(11-20)18-16(21)24-13-5-3-4-6-13/h7-11,13,15H,3-6H2,1-2H3,(H,18,21) |
| InChIKey | OLHJLLIDTDBAHA-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|