C29H31F5N6O — CID 18711757
1-[2-(2,4-difluorophenyl)-3,3-dimethyl-2-(1,2,4-triazol-1-ylmethyl)butyl]-3-[(E)-2-[4-(2,2,3-trifluorobutoxy)phenyl]ethenyl]-1,2,4-triazole (PubChem CID 18711757) has the molecular formula C29H31F5N6O and a molecular weight of 574.60 g/mol. Its IUPAC name is 1-[2-(2,4-difluorophenyl)-3,3-dimethyl-2-(1,2,4-triazol-1-ylmethyl)butyl]-3-[(E)-2-[4-(2,2,3-trifluorobutoxy)phenyl]ethenyl]-1,2,4-triazole.
| Compound Name | 1-[2-(2,4-difluorophenyl)-3,3-dimethyl-2-(1,2,4-triazol-1-ylmethyl)butyl]-3-[(E)-2-[4-(2,2,3-trifluorobutoxy)phenyl]ethenyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 18711757 |
| Molecular Formula | C29H31F5N6O |
| Molecular Weight | 574.60 g/mol |
| Exact Mass | 574.25 |
| IUPAC Name | 1-[2-(2,4-difluorophenyl)-3,3-dimethyl-2-(1,2,4-triazol-1-ylmethyl)butyl]-3-[(E)-2-[4-(2,2,3-trifluorobutoxy)phenyl]ethenyl]-1,2,4-triazole |
| SMILES | CC(F)C(F)(F)COc1ccc(/C=C/c2ncn(CC(Cn3cncn3)(c3ccc(F)cc3F)C(C)(C)C)n2)cc1 |
| InChI | InChI=1S/C29H31F5N6O/c1-20(30)29(33,34)16-41-23-9-5-21(6-10-23)7-12-26-36-19-40(38-26)15-28(27(2,3)4,14-39-18-35-17-37-39)24-11-8-22(31)13-25(24)32/h5-13,17-20H,14-16H2,1-4H3/b12-7+ |
| InChIKey | MJFSJNHEMPLOLU-KPKJPENVSA-N |
| XLogP | 6.37 |
| TPSA | 70.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.60 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |