C38H33F6N6O5P — CID 22266795
dibenzyl [2-(2,4-difluorophenyl)-1-[3-[(E)-2-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]ethenyl]-1,2,4-triazol-1-yl]-3-(1,2,4-triazol-1-yl)propan-2-yl] phosphate (PubChem CID 22266795) has the molecular formula C38H33F6N6O5P and a molecular weight of 798.68 g/mol. Its IUPAC name is dibenzyl [2-(2,4-difluorophenyl)-1-[3-[(E)-2-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]ethenyl]-1,2,4-triazol-1-yl]-3-(1,2,4-triazol-1-yl)propan-2-yl] phosphate.
| Compound Name | dibenzyl [2-(2,4-difluorophenyl)-1-[3-[(E)-2-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]ethenyl]-1,2,4-triazol-1-yl]-3-(1,2,4-triazol-1-yl)propan-2-yl] phosphate |
|---|---|
| PubChem CID | 22266795 |
| Molecular Formula | C38H33F6N6O5P |
| Molecular Weight | 798.68 g/mol |
| Exact Mass | 798.22 |
| IUPAC Name | dibenzyl [2-(2,4-difluorophenyl)-1-[3-[(E)-2-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]ethenyl]-1,2,4-triazol-1-yl]-3-(1,2,4-triazol-1-yl)propan-2-yl] phosphate |
| SMILES | O=P(OCc1ccccc1)(OCc1ccccc1)OC(Cn1cncn1)(Cn1cnc(/C=C/c2ccc(OCC(F)(F)C(F)F)cc2)n1)c1ccc(F)cc1F |
| InChI | InChI=1S/C38H33F6N6O5P/c39-31-14-17-33(34(40)19-31)37(22-49-26-45-25-47-49,55-56(51,53-20-29-7-3-1-4-8-29)54-21-30-9-5-2-6-10-30)23-50-27-46-35(48-50)18-13-28-11-15-32(16-12-28)52-24-38(43,44)36(41)42/h1-19,25-27,36H,20-24H2/b18-13+ |
| InChIKey | CQZBWFZYDKTZAW-QGOAFFKASA-N |
| XLogP | 8.75 |
| TPSA | 115.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.68 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|