About 3-ethyl-5-methyl-1H-1,2,4-triazole
3-ethyl-5-methyl-1H-1,2,4-triazole (PubChem CID 18714263) has the molecular formula C5H9N3
and a molecular weight of 111.15 g/mol. Its IUPAC name is 3-ethyl-5-methyl-1H-1,2,4-triazole.
Molecular Properties
| Compound Name | 3-ethyl-5-methyl-1H-1,2,4-triazole |
| PubChem CID | 18714263 |
| Molecular Formula | C5H9N3 |
| Molecular Weight | 111.15 g/mol |
| Exact Mass | 111.08 |
| IUPAC Name | 3-ethyl-5-methyl-1H-1,2,4-triazole |
| SMILES | CCc1n[nH]c(C)n1 |
| InChI | InChI=1S/C5H9N3/c1-3-5-6-4(2)7-8-5/h3H2,1-2H3,(H,6,7,8) |
| InChIKey | GTLYEWOHOZSGGN-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.15 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethyl-5-methyl-1H-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-5-methyl-1H-1,2,4-triazole?
The IUPAC name of 3-ethyl-5-methyl-1H-1,2,4-triazole (CID 18714263) is 3-ethyl-5-methyl-1H-1,2,4-triazole.
What is the SMILES notation for 3-ethyl-5-methyl-1H-1,2,4-triazole?
The canonical SMILES for 3-ethyl-5-methyl-1H-1,2,4-triazole is CCc1n[nH]c(C)n1.
What is the InChIKey of 3-ethyl-5-methyl-1H-1,2,4-triazole?
The InChIKey is GTLYEWOHOZSGGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3/c1-3-5-6-4(2)7-8-5/h3H2,1-2H3,(H,6,7,8).
What are the key properties of 3-ethyl-5-methyl-1H-1,2,4-triazole?
3-ethyl-5-methyl-1H-1,2,4-triazole has a molecular weight of 111.15 g/mol, XLogP of 0.68, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-5-methyl-1H-1,2,4-triazole is sourced from PubChem (CID 18714263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).