C23H38O6 — CID 18714724
[8-(7-hydroperoxy-3,5-dihydroxyheptyl)-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate (PubChem CID 18714724) has the molecular formula C23H38O6 and a molecular weight of 410.55 g/mol. Its IUPAC name is [8-(7-hydroperoxy-3,5-dihydroxyheptyl)-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate.
| Compound Name | [8-(7-hydroperoxy-3,5-dihydroxyheptyl)-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate |
|---|---|
| PubChem CID | 18714724 |
| Molecular Formula | C23H38O6 |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.27 |
| IUPAC Name | [8-(7-hydroperoxy-3,5-dihydroxyheptyl)-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OC1CCC=C2C=CC(C)C(CCC(O)CC(O)CCOO)C21 |
| InChI | InChI=1S/C23H38O6/c1-4-15(2)23(26)29-21-7-5-6-17-9-8-16(3)20(22(17)21)11-10-18(24)14-19(25)12-13-28-27/h6,8-9,15-16,18-22,24-25,27H,4-5,7,10-14H2,1-3H3 |
| InChIKey | SEMYFECYKFCCHM-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|