C26H41NaO6 — CID 23717339
sodium (3R,5R)-7-[(1S,2S,8S,8aR)-2-methyl-8-(2-propylpentanoyloxy)-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-3,5-dihydroxyheptanoate (PubChem CID 23717339) has the molecular formula C26H41NaO6 and a molecular weight of 472.60 g/mol. Its IUPAC name is sodium (3R,5R)-7-[(1S,2S,8S,8aR)-2-methyl-8-(2-propylpentanoyloxy)-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-3,5-dihydroxyheptanoate.
| Compound Name | sodium (3R,5R)-7-[(1S,2S,8S,8aR)-2-methyl-8-(2-propylpentanoyloxy)-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-3,5-dihydroxyheptanoate |
|---|---|
| PubChem CID | 23717339 |
| Molecular Formula | C26H41NaO6 |
| Molecular Weight | 472.60 g/mol |
| Exact Mass | 472.28 |
| IUPAC Name | sodium (3R,5R)-7-[(1S,2S,8S,8aR)-2-methyl-8-(2-propylpentanoyloxy)-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-3,5-dihydroxyheptanoate |
| SMILES | CCCC(CCC)C(=O)O[C@H]1CCC=C2C=C[C@H](C)[C@H](CC[C@@H](O)C[C@@H](O)CC(=O)[O-])[C@H]21.[Na+] |
| InChI | InChI=1S/C26H42O6.Na/c1-4-7-19(8-5-2)26(31)32-23-10-6-9-18-12-11-17(3)22(25(18)23)14-13-20(27)15-21(28)16-24(29)30;/h9,11-12,17,19-23,25,27-28H,4-8,10,13-16H2,1-3H3,(H,29,30);/q;+1/p-1/t17-,20+,21+,22-,23-,25-;/m0./s1 |
| InChIKey | VAQXLSLMQCUWLM-WWSHWUHPSA-M |
| XLogP | 0.31 |
| TPSA | 106.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.60 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |