C23H34O7 — CID 67883512
1-O-[[(1S,2S,8S,8aR)-2-methyl-8-(2-methylbutanoyloxy)-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]methyl] 5-O-methyl 3-hydroxypentanedioate (PubChem CID 67883512) has the molecular formula C23H34O7 and a molecular weight of 422.52 g/mol. Its IUPAC name is 1-O-[[(1S,2S,8S,8aR)-2-methyl-8-(2-methylbutanoyloxy)-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]methyl] 5-O-methyl 3-hydroxypentanedioate.
| Compound Name | 1-O-[[(1S,2S,8S,8aR)-2-methyl-8-(2-methylbutanoyloxy)-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]methyl] 5-O-methyl 3-hydroxypentanedioate |
|---|---|
| PubChem CID | 67883512 |
| Molecular Formula | C23H34O7 |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | 1-O-[[(1S,2S,8S,8aR)-2-methyl-8-(2-methylbutanoyloxy)-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]methyl] 5-O-methyl 3-hydroxypentanedioate |
| SMILES | CCC(C)C(=O)O[C@H]1CCC=C2C=C[C@H](C)[C@H](COC(=O)CC(O)CC(=O)OC)[C@H]21 |
| InChI | InChI=1S/C23H34O7/c1-5-14(2)23(27)30-19-8-6-7-16-10-9-15(3)18(22(16)19)13-29-21(26)12-17(24)11-20(25)28-4/h7,9-10,14-15,17-19,22,24H,5-6,8,11-13H2,1-4H3/t14?,15-,17?,18-,19-,22-/m0/s1 |
| InChIKey | QHYRJJADFPTMHS-BHQPNHOASA-N |
| XLogP | 2.96 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|