C23H37FO3 — CID 142818395
[(1S,7S,8R,8aR)-7-fluoro-8-[(5S)-5-methylheptyl]-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] (2S,3S)-3-hydroxy-2-methylbutanoate (PubChem CID 142818395) has the molecular formula C23H37FO3 and a molecular weight of 380.54 g/mol. Its IUPAC name is [(1S,7S,8R,8aR)-7-fluoro-8-[(5S)-5-methylheptyl]-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] (2S,3S)-3-hydroxy-2-methylbutanoate.
| Compound Name | [(1S,7S,8R,8aR)-7-fluoro-8-[(5S)-5-methylheptyl]-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] (2S,3S)-3-hydroxy-2-methylbutanoate |
|---|---|
| PubChem CID | 142818395 |
| Molecular Formula | C23H37FO3 |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.27 |
| IUPAC Name | [(1S,7S,8R,8aR)-7-fluoro-8-[(5S)-5-methylheptyl]-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] (2S,3S)-3-hydroxy-2-methylbutanoate |
| SMILES | CC[C@H](C)CCCC[C@@H]1[C@@H]2C(=CCC[C@@H]2OC(=O)[C@@H](C)[C@H](C)O)C=C[C@@H]1F |
| InChI | InChI=1S/C23H37FO3/c1-5-15(2)9-6-7-11-19-20(24)14-13-18-10-8-12-21(22(18)19)27-23(26)16(3)17(4)25/h10,13-17,19-22,25H,5-9,11-12H2,1-4H3/t15-,16-,17-,19-,20-,21-,22-/m0/s1 |
| InChIKey | KOTFVGYMFSOXQQ-SBTDHBFYSA-N |
| XLogP | 5.38 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|