C21H32N2O5 — CID 142193125
[(1S)-7-amino-8-[2-[(2R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-aminobutanoate (PubChem CID 142193125) has the molecular formula C21H32N2O5 and a molecular weight of 392.50 g/mol. Its IUPAC name is [(1S)-7-amino-8-[2-[(2R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-aminobutanoate.
| Compound Name | [(1S)-7-amino-8-[2-[(2R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-aminobutanoate |
|---|---|
| PubChem CID | 142193125 |
| Molecular Formula | C21H32N2O5 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | [(1S)-7-amino-8-[2-[(2R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-aminobutanoate |
| SMILES | CCC(N)C(=O)O[C@H]1CCC=C2C=CC(N)C(CC[C@@H]3CC(O)CC(=O)O3)C21 |
| InChI | InChI=1S/C21H32N2O5/c1-2-16(22)21(26)28-18-5-3-4-12-6-9-17(23)15(20(12)18)8-7-14-10-13(24)11-19(25)27-14/h4,6,9,13-18,20,24H,2-3,5,7-8,10-11,22-23H2,1H3/t13?,14-,15?,16?,17?,18+,20?/m1/s1 |
| InChIKey | AMVYIJPTXZKPAW-ANYPNCNDSA-N |
| XLogP | 1.33 |
| TPSA | 124.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |