C19H26O5 — CID 89291507
[(1S,7S,8S,8aR)-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] formate (PubChem CID 89291507) has the molecular formula C19H26O5 and a molecular weight of 334.41 g/mol. Its IUPAC name is [(1S,7S,8S,8aR)-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] formate.
| Compound Name | [(1S,7S,8S,8aR)-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] formate |
|---|---|
| PubChem CID | 89291507 |
| Molecular Formula | C19H26O5 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | [(1S,7S,8S,8aR)-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] formate |
| SMILES | C[C@H]1C=CC2=CCC[C@H](OC=O)[C@@H]2[C@H]1CC[C@@H]1C[C@@H](O)CC(=O)O1 |
| InChI | InChI=1S/C19H26O5/c1-12-5-6-13-3-2-4-17(23-11-20)19(13)16(12)8-7-15-9-14(21)10-18(22)24-15/h3,5-6,11-12,14-17,19,21H,2,4,7-10H2,1H3/t12-,14+,15+,16-,17-,19-/m0/s1 |
| InChIKey | MSHDXWCFJOFHQQ-PJXYTPJLSA-N |
| XLogP | 2.53 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|