C25H38O5 — CID 118138033
[(7S,8S,8aR)-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2,3-trimethylbutanoate (PubChem CID 118138033) has the molecular formula C25H38O5 and a molecular weight of 418.57 g/mol. Its IUPAC name is [(7S,8S,8aR)-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2,3-trimethylbutanoate.
| Compound Name | [(7S,8S,8aR)-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2,3-trimethylbutanoate |
|---|---|
| PubChem CID | 118138033 |
| Molecular Formula | C25H38O5 |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | [(7S,8S,8aR)-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2,3-trimethylbutanoate |
| SMILES | CC(C)C(C)(C)C(=O)OC1CCC=C2C=C[C@H](C)[C@H](CC[C@@H]3C[C@@H](O)CC(=O)O3)[C@H]21 |
| InChI | InChI=1S/C25H38O5/c1-15(2)25(4,5)24(28)30-21-8-6-7-17-10-9-16(3)20(23(17)21)12-11-19-13-18(26)14-22(27)29-19/h7,9-10,15-16,18-21,23,26H,6,8,11-14H2,1-5H3/t16-,18+,19+,20-,21?,23-/m0/s1 |
| InChIKey | OUUNUAKXWFRODZ-SCDPOZABSA-N |
| XLogP | 4.59 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |