2,3,3,4,4-pentamethylpentan-2-yl nitrate

C10H21NO3 — CID 18714864

IUPAC2,3,3,4,4-pentamethylpentan-2-yl nitrate
SMILESCC(C)(C)C(C)(C)C(C)(C)O[N+](=O)[O-]
InChIInChI=1S/C10H21NO3/c1-8(2,3)9(4,5)10(6,7)14-11(12)13/h1-7H3
InChIKeyJPZFRSFQWGHFHX-UHFFFAOYSA-N
MW203.28 g/mol
LogP3.05
Rot. Bonds3

About 2,3,3,4,4-pentamethylpentan-2-yl nitrate

2,3,3,4,4-pentamethylpentan-2-yl nitrate (PubChem CID 18714864) has the molecular formula C10H21NO3 and a molecular weight of 203.28 g/mol. Its IUPAC name is 2,3,3,4,4-pentamethylpentan-2-yl nitrate.

Molecular Properties

Compound Name2,3,3,4,4-pentamethylpentan-2-yl nitrate
PubChem CID18714864
Molecular FormulaC10H21NO3
Molecular Weight203.28 g/mol
Exact Mass203.15
IUPAC Name2,3,3,4,4-pentamethylpentan-2-yl nitrate
SMILESCC(C)(C)C(C)(C)C(C)(C)O[N+](=O)[O-]
InChIInChI=1S/C10H21NO3/c1-8(2,3)9(4,5)10(6,7)14-11(12)13/h1-7H3
InChIKeyJPZFRSFQWGHFHX-UHFFFAOYSA-N
XLogP3.05
TPSA52.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500203.28
LogP ≤ 53.05
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2,3,3,4,4-pentamethylpentan-2-yl nitrate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3,3,4,4-pentamethylpentan-2-yl nitrate?
The IUPAC name of 2,3,3,4,4-pentamethylpentan-2-yl nitrate (CID 18714864) is 2,3,3,4,4-pentamethylpentan-2-yl nitrate.
What is the SMILES notation for 2,3,3,4,4-pentamethylpentan-2-yl nitrate?
The canonical SMILES for 2,3,3,4,4-pentamethylpentan-2-yl nitrate is CC(C)(C)C(C)(C)C(C)(C)O[N+](=O)[O-].
What is the InChIKey of 2,3,3,4,4-pentamethylpentan-2-yl nitrate?
The InChIKey is JPZFRSFQWGHFHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO3/c1-8(2,3)9(4,5)10(6,7)14-11(12)13/h1-7H3.
What are the key properties of 2,3,3,4,4-pentamethylpentan-2-yl nitrate?
2,3,3,4,4-pentamethylpentan-2-yl nitrate has a molecular weight of 203.28 g/mol, XLogP of 3.05, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,3,4,4-pentamethylpentan-2-yl nitrate is sourced from PubChem (CID 18714864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).