C10H21NO3 — CID 18714864
2,3,3,4,4-pentamethylpentan-2-yl nitrate (PubChem CID 18714864) has the molecular formula C10H21NO3 and a molecular weight of 203.28 g/mol. Its IUPAC name is 2,3,3,4,4-pentamethylpentan-2-yl nitrate.
| Compound Name | 2,3,3,4,4-pentamethylpentan-2-yl nitrate |
|---|---|
| PubChem CID | 18714864 |
| Molecular Formula | C10H21NO3 |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | 2,3,3,4,4-pentamethylpentan-2-yl nitrate |
| SMILES | CC(C)(C)C(C)(C)C(C)(C)O[N+](=O)[O-] |
| InChI | InChI=1S/C10H21NO3/c1-8(2,3)9(4,5)10(6,7)14-11(12)13/h1-7H3 |
| InChIKey | JPZFRSFQWGHFHX-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|