C12H24N2O5 — CID 54132866
[2,2,6,6-tetramethyl-4-(nitromethyl)heptan-4-yl] nitrate (PubChem CID 54132866) has the molecular formula C12H24N2O5 and a molecular weight of 276.33 g/mol. Its IUPAC name is [2,2,6,6-tetramethyl-4-(nitromethyl)heptan-4-yl] nitrate.
| Compound Name | [2,2,6,6-tetramethyl-4-(nitromethyl)heptan-4-yl] nitrate |
|---|---|
| PubChem CID | 54132866 |
| Molecular Formula | C12H24N2O5 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | [2,2,6,6-tetramethyl-4-(nitromethyl)heptan-4-yl] nitrate |
| SMILES | CC(C)(C)CC(C[N+](=O)[O-])(CC(C)(C)C)O[N+](=O)[O-] |
| InChI | InChI=1S/C12H24N2O5/c1-10(2,3)7-12(9-13(15)16,19-14(17)18)8-11(4,5)6/h7-9H2,1-6H3 |
| InChIKey | NVOVFPHGBWNSBB-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 95.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|