[2,2,6,6-tetramethyl-4-(nitromethyl)heptan-4-yl] nitrate

C12H24N2O5 — CID 54132866

IUPAC[2,2,6,6-tetramethyl-4-(nitromethyl)heptan-4-yl] nitrate
SMILESCC(C)(C)CC(C[N+](=O)[O-])(CC(C)(C)C)O[N+](=O)[O-]
InChIInChI=1S/C12H24N2O5/c1-10(2,3)7-12(9-13(15)16,19-14(17)18)8-11(4,5)6/h7-9H2,1-6H3
InChIKeyNVOVFPHGBWNSBB-UHFFFAOYSA-N
MW276.33 g/mol
LogP3.08
Rot. Bonds6

About [2,2,6,6-tetramethyl-4-(nitromethyl)heptan-4-yl] nitrate

[2,2,6,6-tetramethyl-4-(nitromethyl)heptan-4-yl] nitrate (PubChem CID 54132866) has the molecular formula C12H24N2O5 and a molecular weight of 276.33 g/mol. Its IUPAC name is [2,2,6,6-tetramethyl-4-(nitromethyl)heptan-4-yl] nitrate.

Molecular Properties

Compound Name[2,2,6,6-tetramethyl-4-(nitromethyl)heptan-4-yl] nitrate
PubChem CID54132866
Molecular FormulaC12H24N2O5
Molecular Weight276.33 g/mol
Exact Mass276.17
IUPAC Name[2,2,6,6-tetramethyl-4-(nitromethyl)heptan-4-yl] nitrate
SMILESCC(C)(C)CC(C[N+](=O)[O-])(CC(C)(C)C)O[N+](=O)[O-]
InChIInChI=1S/C12H24N2O5/c1-10(2,3)7-12(9-13(15)16,19-14(17)18)8-11(4,5)6/h7-9H2,1-6H3
InChIKeyNVOVFPHGBWNSBB-UHFFFAOYSA-N
XLogP3.08
TPSA95.51 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500276.33
LogP ≤ 53.08
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze [2,2,6,6-tetramethyl-4-(nitromethyl)heptan-4-yl] nitrate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [2,2,6,6-tetramethyl-4-(nitromethyl)heptan-4-yl] nitrate?
The IUPAC name of [2,2,6,6-tetramethyl-4-(nitromethyl)heptan-4-yl] nitrate (CID 54132866) is [2,2,6,6-tetramethyl-4-(nitromethyl)heptan-4-yl] nitrate.
What is the SMILES notation for [2,2,6,6-tetramethyl-4-(nitromethyl)heptan-4-yl] nitrate?
The canonical SMILES for [2,2,6,6-tetramethyl-4-(nitromethyl)heptan-4-yl] nitrate is CC(C)(C)CC(C[N+](=O)[O-])(CC(C)(C)C)O[N+](=O)[O-].
What is the InChIKey of [2,2,6,6-tetramethyl-4-(nitromethyl)heptan-4-yl] nitrate?
The InChIKey is NVOVFPHGBWNSBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O5/c1-10(2,3)7-12(9-13(15)16,19-14(17)18)8-11(4,5)6/h7-9H2,1-6H3.
What are the key properties of [2,2,6,6-tetramethyl-4-(nitromethyl)heptan-4-yl] nitrate?
[2,2,6,6-tetramethyl-4-(nitromethyl)heptan-4-yl] nitrate has a molecular weight of 276.33 g/mol, XLogP of 3.08, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2,2,6,6-tetramethyl-4-(nitromethyl)heptan-4-yl] nitrate is sourced from PubChem (CID 54132866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).