C26H24Cl2N3O2+ — CID 18715108
4-(6,13-dichloro-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaenylidene)-N-(1-hydroxypyridin-1-ium-4-yl)piperidine-1-carboxamide (PubChem CID 18715108) has the molecular formula C26H24Cl2N3O2+ and a molecular weight of 481.40 g/mol. Its IUPAC name is 4-(6,13-dichloro-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaenylidene)-N-(1-hydroxypyridin-1-ium-4-yl)piperidine-1-carboxamide.
| Compound Name | 4-(6,13-dichloro-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaenylidene)-N-(1-hydroxypyridin-1-ium-4-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 18715108 |
| Molecular Formula | C26H24Cl2N3O2+ |
| Molecular Weight | 481.40 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | 4-(6,13-dichloro-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaenylidene)-N-(1-hydroxypyridin-1-ium-4-yl)piperidine-1-carboxamide |
| SMILES | O=C(Nc1cc[n+](O)cc1)N1CCC(=C2c3ccc(Cl)cc3CCc3cc(Cl)ccc32)CC1 |
| InChI | InChI=1S/C26H23Cl2N3O2/c27-20-3-5-23-18(15-20)1-2-19-16-21(28)4-6-24(19)25(23)17-7-11-30(12-8-17)26(32)29-22-9-13-31(33)14-10-22/h3-6,9-10,13-16,33H,1-2,7-8,11-12H2/p+1 |
| InChIKey | SHSBAZCJKYTELX-UHFFFAOYSA-O |
| XLogP | 5.75 |
| TPSA | 56.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.40 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'styrene_A(13)', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|