C11H16O4 — CID 18716223
5-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-methyl-3-methylideneoxolan-2-one (PubChem CID 18716223) has the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. Its IUPAC name is 5-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-methyl-3-methylideneoxolan-2-one.
| Compound Name | 5-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-methyl-3-methylideneoxolan-2-one |
|---|---|
| PubChem CID | 18716223 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 5-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-methyl-3-methylideneoxolan-2-one |
| SMILES | C=C1C(=O)OC(C2COC(C)(C)O2)C1C |
| InChI | InChI=1S/C11H16O4/c1-6-7(2)10(12)14-9(6)8-5-13-11(3,4)15-8/h6,8-9H,2,5H2,1,3-4H3 |
| InChIKey | HWXFIEZWLMQTHZ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|