C38H66N4O6 — CID 18716416
1-(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl)-3-[2-[1-(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl)-4-(2-methylbutyl)-2,5-dioxopyrrolidin-3-yl]butyl]-4-methylpyrrolidine-2,5-dione (PubChem CID 18716416) has the molecular formula C38H66N4O6 and a molecular weight of 674.97 g/mol. Its IUPAC name is 1-(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl)-3-[2-[1-(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl)-4-(2-methylbutyl)-2,5-dioxopyrrolidin-3-yl]butyl]-4-methylpyrrolidine-2,5-dione.
| Compound Name | 1-(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl)-3-[2-[1-(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl)-4-(2-methylbutyl)-2,5-dioxopyrrolidin-3-yl]butyl]-4-methylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 18716416 |
| Molecular Formula | C38H66N4O6 |
| Molecular Weight | 674.97 g/mol |
| Exact Mass | 674.50 |
| IUPAC Name | 1-(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl)-3-[2-[1-(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl)-4-(2-methylbutyl)-2,5-dioxopyrrolidin-3-yl]butyl]-4-methylpyrrolidine-2,5-dione |
| SMILES | CCC(C)CC1C(=O)N(C2CC(C)(C)N(OC)C(C)(C)C2)C(=O)C1C(CC)CC1C(=O)N(C2CC(C)(C)N(OC)C(C)(C)C2)C(=O)C1C |
| InChI | InChI=1S/C38H66N4O6/c1-15-23(3)17-29-30(34(46)40(33(29)45)27-21-37(9,10)42(48-14)38(11,12)22-27)25(16-2)18-28-24(4)31(43)39(32(28)44)26-19-35(5,6)41(47-13)36(7,8)20-26/h23-30H,15-22H2,1-14H3 |
| InChIKey | QONIRCFURKFBMX-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 99.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.97 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|