C39H68N4O4 — CID 20768150
3-methyl-4-[2-[[4-(2-methylbutyl)-2,5-dioxo-1-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrrolidin-3-yl]methyl]butyl]-1-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrrolidine-2,5-dione (PubChem CID 20768150) has the molecular formula C39H68N4O4 and a molecular weight of 657.00 g/mol. Its IUPAC name is 3-methyl-4-[2-[[4-(2-methylbutyl)-2,5-dioxo-1-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrrolidin-3-yl]methyl]butyl]-1-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrrolidine-2,5-dione.
| Compound Name | 3-methyl-4-[2-[[4-(2-methylbutyl)-2,5-dioxo-1-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrrolidin-3-yl]methyl]butyl]-1-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 20768150 |
| Molecular Formula | C39H68N4O4 |
| Molecular Weight | 657.00 g/mol |
| Exact Mass | 656.52 |
| IUPAC Name | 3-methyl-4-[2-[[4-(2-methylbutyl)-2,5-dioxo-1-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrrolidin-3-yl]methyl]butyl]-1-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrrolidine-2,5-dione |
| SMILES | CCC(C)CC1C(=O)N(C2CC(C)(C)N(C)C(C)(C)C2)C(=O)C1CC(CC)CC1C(=O)N(C2CC(C)(C)N(C)C(C)(C)C2)C(=O)C1C |
| InChI | InChI=1S/C39H68N4O4/c1-15-24(3)17-30-31(35(47)43(34(30)46)28-22-38(9,10)41(14)39(11,12)23-28)19-26(16-2)18-29-25(4)32(44)42(33(29)45)27-20-36(5,6)40(13)37(7,8)21-27/h24-31H,15-23H2,1-14H3 |
| InChIKey | QHHDUTRYCVQGFJ-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 81.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.00 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|