C26H42N4O4 — CID 14365941
3-[2,5-dioxo-1-(2,2,6,6-tetramethylpiperidin-4-yl)pyrrolidin-3-yl]-1-(2,2,6,6-tetramethylpiperidin-4-yl)pyrrolidine-2,5-dione (PubChem CID 14365941) has the molecular formula C26H42N4O4 and a molecular weight of 474.65 g/mol. Its IUPAC name is 3-[2,5-dioxo-1-(2,2,6,6-tetramethylpiperidin-4-yl)pyrrolidin-3-yl]-1-(2,2,6,6-tetramethylpiperidin-4-yl)pyrrolidine-2,5-dione.
| Compound Name | 3-[2,5-dioxo-1-(2,2,6,6-tetramethylpiperidin-4-yl)pyrrolidin-3-yl]-1-(2,2,6,6-tetramethylpiperidin-4-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 14365941 |
| Molecular Formula | C26H42N4O4 |
| Molecular Weight | 474.65 g/mol |
| Exact Mass | 474.32 |
| IUPAC Name | 3-[2,5-dioxo-1-(2,2,6,6-tetramethylpiperidin-4-yl)pyrrolidin-3-yl]-1-(2,2,6,6-tetramethylpiperidin-4-yl)pyrrolidine-2,5-dione |
| SMILES | CC1(C)CC(N2C(=O)CC(C3CC(=O)N(C4CC(C)(C)NC(C)(C)C4)C3=O)C2=O)CC(C)(C)N1 |
| InChI | InChI=1S/C26H42N4O4/c1-23(2)11-15(12-24(3,4)27-23)29-19(31)9-17(21(29)33)18-10-20(32)30(22(18)34)16-13-25(5,6)28-26(7,8)14-16/h15-18,27-28H,9-14H2,1-8H3 |
| InChIKey | NZPXIYUEDVYIAW-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.65 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|