C28H44N4O4 — CID 54056838
2,6-bis(2,2,6,6-tetramethylpiperidin-4-yl)-3a,4,4a,7a,8,8a-hexahydropyrrolo[3,4-f]isoindole-1,3,5,7-tetrone (PubChem CID 54056838) has the molecular formula C28H44N4O4 and a molecular weight of 500.68 g/mol. Its IUPAC name is 2,6-bis(2,2,6,6-tetramethylpiperidin-4-yl)-3a,4,4a,7a,8,8a-hexahydropyrrolo[3,4-f]isoindole-1,3,5,7-tetrone.
| Compound Name | 2,6-bis(2,2,6,6-tetramethylpiperidin-4-yl)-3a,4,4a,7a,8,8a-hexahydropyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 54056838 |
| Molecular Formula | C28H44N4O4 |
| Molecular Weight | 500.68 g/mol |
| Exact Mass | 500.34 |
| IUPAC Name | 2,6-bis(2,2,6,6-tetramethylpiperidin-4-yl)-3a,4,4a,7a,8,8a-hexahydropyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
| SMILES | CC1(C)CC(N2C(=O)C3CC4C(=O)N(C5CC(C)(C)NC(C)(C)C5)C(=O)C4CC3C2=O)CC(C)(C)N1 |
| InChI | InChI=1S/C28H44N4O4/c1-25(2)11-15(12-26(3,4)29-25)31-21(33)17-9-19-20(10-18(17)22(31)34)24(36)32(23(19)35)16-13-27(5,6)30-28(7,8)14-16/h15-20,29-30H,9-14H2,1-8H3 |
| InChIKey | BSCGSVWCQDZCOG-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.68 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|