C20H30N3OPS2 — CID 18717612
4-dimethylphosphinothioyl-2-[[1-hydroxy-2,2-dimethyl-5-(2-phenylethyl)cyclopentyl]methyl]-1,2,4-triazole-3-thione (PubChem CID 18717612) has the molecular formula C20H30N3OPS2 and a molecular weight of 423.59 g/mol. Its IUPAC name is 4-dimethylphosphinothioyl-2-[[1-hydroxy-2,2-dimethyl-5-(2-phenylethyl)cyclopentyl]methyl]-1,2,4-triazole-3-thione.
| Compound Name | 4-dimethylphosphinothioyl-2-[[1-hydroxy-2,2-dimethyl-5-(2-phenylethyl)cyclopentyl]methyl]-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 18717612 |
| Molecular Formula | C20H30N3OPS2 |
| Molecular Weight | 423.59 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | 4-dimethylphosphinothioyl-2-[[1-hydroxy-2,2-dimethyl-5-(2-phenylethyl)cyclopentyl]methyl]-1,2,4-triazole-3-thione |
| SMILES | CC1(C)CCC(CCc2ccccc2)C1(O)Cn1ncn(P(C)(C)=S)c1=S |
| InChI | InChI=1S/C20H30N3OPS2/c1-19(2)13-12-17(11-10-16-8-6-5-7-9-16)20(19,24)14-22-18(26)23(15-21-22)25(3,4)27/h5-9,15,17,24H,10-14H2,1-4H3 |
| InChIKey | RHGINEBKOLAHQF-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 42.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.59 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|