C15H19NO2 — CID 14202075
(3S,3aS,6aR)-6a-hydroxy-3-(2-phenylethyl)-1,3,3a,4,5,6-hexahydrocyclopenta[b]pyrrol-2-one (PubChem CID 14202075) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is (3S,3aS,6aR)-6a-hydroxy-3-(2-phenylethyl)-1,3,3a,4,5,6-hexahydrocyclopenta[b]pyrrol-2-one.
| Compound Name | (3S,3aS,6aR)-6a-hydroxy-3-(2-phenylethyl)-1,3,3a,4,5,6-hexahydrocyclopenta[b]pyrrol-2-one |
|---|---|
| PubChem CID | 14202075 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | (3S,3aS,6aR)-6a-hydroxy-3-(2-phenylethyl)-1,3,3a,4,5,6-hexahydrocyclopenta[b]pyrrol-2-one |
| SMILES | O=C1N[C@@]2(O)CCC[C@H]2[C@@H]1CCc1ccccc1 |
| InChI | InChI=1S/C15H19NO2/c17-14-12(9-8-11-5-2-1-3-6-11)13-7-4-10-15(13,18)16-14/h1-3,5-6,12-13,18H,4,7-10H2,(H,16,17)/t12-,13-,15+/m0/s1 |
| InChIKey | BNUBGYCZUHGKMI-KCQAQPDRSA-N |
| XLogP | 1.85 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |