C26H36Cl2FeN3O2 — CID 18719201
bis[1-methoxy-2-(2,4,6-trimethylphenyl)iminopropyl]azanide;dichloroiron(1+) (PubChem CID 18719201) has the molecular formula C26H36Cl2FeN3O2 and a molecular weight of 549.34 g/mol. Its IUPAC name is bis[1-methoxy-2-(2,4,6-trimethylphenyl)iminopropyl]azanide;dichloroiron(1+).
| Compound Name | bis[1-methoxy-2-(2,4,6-trimethylphenyl)iminopropyl]azanide;dichloroiron(1+) |
|---|---|
| PubChem CID | 18719201 |
| Molecular Formula | C26H36Cl2FeN3O2 |
| Molecular Weight | 549.34 g/mol |
| Exact Mass | 548.15 |
| IUPAC Name | bis[1-methoxy-2-(2,4,6-trimethylphenyl)iminopropyl]azanide;dichloroiron(1+) |
| SMILES | COC([N-]C(OC)/C(C)=N/c1c(C)cc(C)cc1C)/C(C)=N/c1c(C)cc(C)cc1C.Cl[Fe+]Cl |
| InChI | InChI=1S/C26H36N3O2.2ClH.Fe/c1-15-11-17(3)23(18(4)12-15)27-21(7)25(30-9)29-26(31-10)22(8)28-24-19(5)13-16(2)14-20(24)6;;;/h11-14,25-26H,1-10H3;2*1H;/q-1;;;+3/p-2/b27-21+,28-22+;;; |
| InChIKey | YXQKKXDYUVTWQA-GBJOXJENSA-L |
| XLogP | 8.12 |
| TPSA | 57.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.34 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|