C22H27Cl2FeN3O2 — CID 18718491
dichloroiron;methyl (1E)-2-(2,6-dimethylphenyl)imino-N-[2-(2,6-dimethylphenyl)imino-1-methoxyethyl]ethanimidate (PubChem CID 18718491) has the molecular formula C22H27Cl2FeN3O2 and a molecular weight of 492.23 g/mol. Its IUPAC name is dichloroiron;methyl (1E)-2-(2,6-dimethylphenyl)imino-N-[2-(2,6-dimethylphenyl)imino-1-methoxyethyl]ethanimidate.
| Compound Name | dichloroiron;methyl (1E)-2-(2,6-dimethylphenyl)imino-N-[2-(2,6-dimethylphenyl)imino-1-methoxyethyl]ethanimidate |
|---|---|
| PubChem CID | 18718491 |
| Molecular Formula | C22H27Cl2FeN3O2 |
| Molecular Weight | 492.23 g/mol |
| Exact Mass | 491.08 |
| IUPAC Name | dichloroiron;methyl (1E)-2-(2,6-dimethylphenyl)imino-N-[2-(2,6-dimethylphenyl)imino-1-methoxyethyl]ethanimidate |
| SMILES | COC(/C=N/c1c(C)cccc1C)=N/C(/C=N/c1c(C)cccc1C)OC.Cl[Fe]Cl |
| InChI | InChI=1S/C22H27N3O2.2ClH.Fe/c1-15-9-7-10-16(2)21(15)23-13-19(26-5)25-20(27-6)14-24-22-17(3)11-8-12-18(22)4;;;/h7-14,19H,1-6H3;2*1H;/q;;;+2/p-2/b23-13+,24-14+,25-20+;;; |
| InChIKey | HAERCCAKRKYDQM-SKXXRUHFSA-L |
| XLogP | 6.42 |
| TPSA | 55.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.23 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|