About 1-(2-methoxyethoxy)-2,5-dimethylhexane
1-(2-methoxyethoxy)-2,5-dimethylhexane (PubChem CID 18720488) has the molecular formula C11H24O2
and a molecular weight of 188.31 g/mol. Its IUPAC name is 1-(2-methoxyethoxy)-2,5-dimethylhexane.
Molecular Properties
| Compound Name | 1-(2-methoxyethoxy)-2,5-dimethylhexane |
| PubChem CID | 18720488 |
| Molecular Formula | C11H24O2 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.18 |
| IUPAC Name | 1-(2-methoxyethoxy)-2,5-dimethylhexane |
| SMILES | COCCOCC(C)CCC(C)C |
| InChI | InChI=1S/C11H24O2/c1-10(2)5-6-11(3)9-13-8-7-12-4/h10-11H,5-9H2,1-4H3 |
| InChIKey | HZGANRVZHMQMCP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-methoxyethoxy)-2,5-dimethylhexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methoxyethoxy)-2,5-dimethylhexane?
The IUPAC name of 1-(2-methoxyethoxy)-2,5-dimethylhexane (CID 18720488) is 1-(2-methoxyethoxy)-2,5-dimethylhexane.
What is the SMILES notation for 1-(2-methoxyethoxy)-2,5-dimethylhexane?
The canonical SMILES for 1-(2-methoxyethoxy)-2,5-dimethylhexane is COCCOCC(C)CCC(C)C.
What is the InChIKey of 1-(2-methoxyethoxy)-2,5-dimethylhexane?
The InChIKey is HZGANRVZHMQMCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24O2/c1-10(2)5-6-11(3)9-13-8-7-12-4/h10-11H,5-9H2,1-4H3.
What are the key properties of 1-(2-methoxyethoxy)-2,5-dimethylhexane?
1-(2-methoxyethoxy)-2,5-dimethylhexane has a molecular weight of 188.31 g/mol, XLogP of 2.72, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methoxyethoxy)-2,5-dimethylhexane is sourced from PubChem (CID 18720488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).