C9H14O5 — CID 18721084
3,4,5-trimethoxy-6-methylideneoxan-2-one (PubChem CID 18721084) has the molecular formula C9H14O5 and a molecular weight of 202.21 g/mol. Its IUPAC name is 3,4,5-trimethoxy-6-methylideneoxan-2-one.
| Compound Name | 3,4,5-trimethoxy-6-methylideneoxan-2-one |
|---|---|
| PubChem CID | 18721084 |
| Molecular Formula | C9H14O5 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | 3,4,5-trimethoxy-6-methylideneoxan-2-one |
| SMILES | C=C1OC(=O)C(OC)C(OC)C1OC |
| InChI | InChI=1S/C9H14O5/c1-5-6(11-2)7(12-3)8(13-4)9(10)14-5/h6-8H,1H2,2-4H3 |
| InChIKey | FDJVQULYRXKUJF-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |