C13H16O9 — CID 11088372
methyl (2S,3S,4S)-3,4,5-triacetyloxy-3,4-dihydro-2H-pyran-2-carboxylate (PubChem CID 11088372) has the molecular formula C13H16O9 and a molecular weight of 316.26 g/mol. Its IUPAC name is methyl (2S,3S,4S)-3,4,5-triacetyloxy-3,4-dihydro-2H-pyran-2-carboxylate.
| Compound Name | methyl (2S,3S,4S)-3,4,5-triacetyloxy-3,4-dihydro-2H-pyran-2-carboxylate |
|---|---|
| PubChem CID | 11088372 |
| Molecular Formula | C13H16O9 |
| Molecular Weight | 316.26 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | methyl (2S,3S,4S)-3,4,5-triacetyloxy-3,4-dihydro-2H-pyran-2-carboxylate |
| SMILES | COC(=O)[C@H]1OC=C(OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C13H16O9/c1-6(14)20-9-5-19-12(13(17)18-4)11(22-8(3)16)10(9)21-7(2)15/h5,10-12H,1-4H3/t10-,11+,12+/m1/s1 |
| InChIKey | CYRDRVVCHQYGJF-WOPDTQHZSA-N |
| XLogP | -0.17 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.26 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|