C17H26N3S+ — CID 18721225
2-methyl-4-octyl-3-phenyl-1H-1,2,4-triazol-4-ium-5-thione (PubChem CID 18721225) has the molecular formula C17H26N3S+ and a molecular weight of 304.48 g/mol. Its IUPAC name is 2-methyl-4-octyl-3-phenyl-1H-1,2,4-triazol-4-ium-5-thione.
| Compound Name | 2-methyl-4-octyl-3-phenyl-1H-1,2,4-triazol-4-ium-5-thione |
|---|---|
| PubChem CID | 18721225 |
| Molecular Formula | C17H26N3S+ |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 2-methyl-4-octyl-3-phenyl-1H-1,2,4-triazol-4-ium-5-thione |
| SMILES | CCCCCCCC[n+]1c(-c2ccccc2)n(C)[nH]c1=S |
| InChI | InChI=1S/C17H25N3S/c1-3-4-5-6-7-11-14-20-16(19(2)18-17(20)21)15-12-9-8-10-13-15/h8-10,12-13H,3-7,11,14H2,1-2H3/p+1 |
| InChIKey | WDOZCVCDQMSVMN-UHFFFAOYSA-O |
| XLogP | 4.40 |
| TPSA | 24.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|