C21H24BrClN2O2 — CID 18722690
6-bromo-13-chloro-2-[2-(hydroperoxymethyl)-1-methylpiperidin-4-yl]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene (PubChem CID 18722690) has the molecular formula C21H24BrClN2O2 and a molecular weight of 451.79 g/mol. Its IUPAC name is 6-bromo-13-chloro-2-[2-(hydroperoxymethyl)-1-methylpiperidin-4-yl]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene.
| Compound Name | 6-bromo-13-chloro-2-[2-(hydroperoxymethyl)-1-methylpiperidin-4-yl]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene |
|---|---|
| PubChem CID | 18722690 |
| Molecular Formula | C21H24BrClN2O2 |
| Molecular Weight | 451.79 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | 6-bromo-13-chloro-2-[2-(hydroperoxymethyl)-1-methylpiperidin-4-yl]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene |
| SMILES | CN1CCC(C2c3ccc(Cl)cc3CCc3cc(Br)cnc32)CC1COO |
| InChI | InChI=1S/C21H24BrClN2O2/c1-25-7-6-14(10-18(25)12-27-26)20-19-5-4-17(23)9-13(19)2-3-15-8-16(22)11-24-21(15)20/h4-5,8-9,11,14,18,20,26H,2-3,6-7,10,12H2,1H3 |
| InChIKey | RACFHNFBPPVJRS-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.79 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|