C20H22BrClN2O2 — CID 18713086
6-bromo-13-chloro-2-[2-(hydroperoxymethyl)piperidin-4-yl]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene (PubChem CID 18713086) has the molecular formula C20H22BrClN2O2 and a molecular weight of 437.77 g/mol. Its IUPAC name is 6-bromo-13-chloro-2-[2-(hydroperoxymethyl)piperidin-4-yl]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene.
| Compound Name | 6-bromo-13-chloro-2-[2-(hydroperoxymethyl)piperidin-4-yl]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene |
|---|---|
| PubChem CID | 18713086 |
| Molecular Formula | C20H22BrClN2O2 |
| Molecular Weight | 437.77 g/mol |
| Exact Mass | 436.06 |
| IUPAC Name | 6-bromo-13-chloro-2-[2-(hydroperoxymethyl)piperidin-4-yl]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene |
| SMILES | OOCC1CC(C2c3ccc(Cl)cc3CCc3cc(Br)cnc32)CCN1 |
| InChI | InChI=1S/C20H22BrClN2O2/c21-15-7-14-2-1-12-8-16(22)3-4-18(12)19(20(14)24-10-15)13-5-6-23-17(9-13)11-26-25/h3-4,7-8,10,13,17,19,23,25H,1-2,5-6,9,11H2 |
| InChIKey | BSORMFNNOCALGF-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.77 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|