C22H29BrN2 — CID 142002599
(2R)-6-bromo-13-methyl-2-piperidin-4-yl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene;ethane (PubChem CID 142002599) has the molecular formula C22H29BrN2 and a molecular weight of 401.39 g/mol. Its IUPAC name is (2R)-6-bromo-13-methyl-2-piperidin-4-yl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene;ethane.
| Compound Name | (2R)-6-bromo-13-methyl-2-piperidin-4-yl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene;ethane |
|---|---|
| PubChem CID | 142002599 |
| Molecular Formula | C22H29BrN2 |
| Molecular Weight | 401.39 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | (2R)-6-bromo-13-methyl-2-piperidin-4-yl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene;ethane |
| SMILES | CC.Cc1ccc2c(c1)CCc1cc(Br)cnc1[C@@H]2C1CCNCC1 |
| InChI | InChI=1S/C20H23BrN2.C2H6/c1-13-2-5-18-15(10-13)3-4-16-11-17(21)12-23-20(16)19(18)14-6-8-22-9-7-14;1-2/h2,5,10-12,14,19,22H,3-4,6-9H2,1H3;1-2H3/t19-;/m1./s1 |
| InChIKey | BDIKOUNOIQXIDR-FSRHSHDFSA-N |
| XLogP | 5.41 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.39 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |