C27H30FN3O — CID 18723513
[3-ethenyl-4-[[4-(4-fluorophenyl)piperidin-1-yl]methyl]pyrrolidin-1-yl]-(1H-indol-7-yl)methanone (PubChem CID 18723513) has the molecular formula C27H30FN3O and a molecular weight of 431.56 g/mol. Its IUPAC name is [3-ethenyl-4-[[4-(4-fluorophenyl)piperidin-1-yl]methyl]pyrrolidin-1-yl]-(1H-indol-7-yl)methanone.
| Compound Name | [3-ethenyl-4-[[4-(4-fluorophenyl)piperidin-1-yl]methyl]pyrrolidin-1-yl]-(1H-indol-7-yl)methanone |
|---|---|
| PubChem CID | 18723513 |
| Molecular Formula | C27H30FN3O |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.24 |
| IUPAC Name | [3-ethenyl-4-[[4-(4-fluorophenyl)piperidin-1-yl]methyl]pyrrolidin-1-yl]-(1H-indol-7-yl)methanone |
| SMILES | C=CC1CN(C(=O)c2cccc3cc[nH]c23)CC1CN1CCC(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C27H30FN3O/c1-2-19-17-31(27(32)25-5-3-4-22-10-13-29-26(22)25)18-23(19)16-30-14-11-21(12-15-30)20-6-8-24(28)9-7-20/h2-10,13,19,21,23,29H,1,11-12,14-18H2 |
| InChIKey | YPQMBEHHPCRKIY-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|