C16H28O6 — CID 18724445
2-ethyl-4,6-bis(methoxycarbonyl)-2,4-dimethyloctanoic acid (PubChem CID 18724445) has the molecular formula C16H28O6 and a molecular weight of 316.39 g/mol. Its IUPAC name is 2-ethyl-4,6-bis(methoxycarbonyl)-2,4-dimethyloctanoic acid.
| Compound Name | 2-ethyl-4,6-bis(methoxycarbonyl)-2,4-dimethyloctanoic acid |
|---|---|
| PubChem CID | 18724445 |
| Molecular Formula | C16H28O6 |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 2-ethyl-4,6-bis(methoxycarbonyl)-2,4-dimethyloctanoic acid |
| SMILES | CCC(CC(C)(CC(C)(CC)C(=O)O)C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C16H28O6/c1-7-11(12(17)21-5)9-16(4,14(20)22-6)10-15(3,8-2)13(18)19/h11H,7-10H2,1-6H3,(H,18,19) |
| InChIKey | WUNIXLRTVNMVEV-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |