C21H17ClFN5O3 — CID 18727587
4-carbamimidoyl-N-[2-[(5-chloro-2-pyridinyl)carbamoyl]-4-methoxyphenyl]-2-fluorobenzamide (PubChem CID 18727587) has the molecular formula C21H17ClFN5O3 and a molecular weight of 441.85 g/mol. Its IUPAC name is 4-carbamimidoyl-N-[2-[(5-chloro-2-pyridinyl)carbamoyl]-4-methoxyphenyl]-2-fluorobenzamide.
| Compound Name | 4-carbamimidoyl-N-[2-[(5-chloro-2-pyridinyl)carbamoyl]-4-methoxyphenyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 18727587 |
| Molecular Formula | C21H17ClFN5O3 |
| Molecular Weight | 441.85 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | 4-carbamimidoyl-N-[2-[(5-chloro-2-pyridinyl)carbamoyl]-4-methoxyphenyl]-2-fluorobenzamide |
| SMILES | [H]/N=C(\N)c1ccc(C(=O)Nc2ccc(OC)cc2C(=O)Nc2ccc(Cl)cn2)c(F)c1 |
| InChI | InChI=1S/C21H17ClFN5O3/c1-31-13-4-6-17(15(9-13)21(30)28-18-7-3-12(22)10-26-18)27-20(29)14-5-2-11(19(24)25)8-16(14)23/h2-10H,1H3,(H3,24,25)(H,27,29)(H,26,28,30) |
| InChIKey | ITYYYRDELOWBQJ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 130.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.85 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|