About 2-fluoro-N'-methylethanimidamide
2-fluoro-N'-methylethanimidamide (PubChem CID 18727673) has the molecular formula C3H7FN2
and a molecular weight of 90.10 g/mol. Its IUPAC name is 2-fluoro-N'-methylethanimidamide.
Molecular Properties
| Compound Name | 2-fluoro-N'-methylethanimidamide |
| PubChem CID | 18727673 |
| Molecular Formula | C3H7FN2 |
| Molecular Weight | 90.10 g/mol |
| Exact Mass | 90.06 |
| IUPAC Name | 2-fluoro-N'-methylethanimidamide |
| SMILES | C/N=C(/N)CF |
| InChI | InChI=1S/C3H7FN2/c1-6-3(5)2-4/h2H2,1H3,(H2,5,6) |
| InChIKey | JOCISEYCNIRMLH-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 90.10 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-N'-methylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-N'-methylethanimidamide?
The IUPAC name of 2-fluoro-N'-methylethanimidamide (CID 18727673) is 2-fluoro-N'-methylethanimidamide.
What is the SMILES notation for 2-fluoro-N'-methylethanimidamide?
The canonical SMILES for 2-fluoro-N'-methylethanimidamide is C/N=C(/N)CF.
What is the InChIKey of 2-fluoro-N'-methylethanimidamide?
The InChIKey is JOCISEYCNIRMLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7FN2/c1-6-3(5)2-4/h2H2,1H3,(H2,5,6).
What are the key properties of 2-fluoro-N'-methylethanimidamide?
2-fluoro-N'-methylethanimidamide has a molecular weight of 90.10 g/mol, XLogP of -0.06, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-N'-methylethanimidamide is sourced from PubChem (CID 18727673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).