About 2-fluoro-N'-methylpropanimidamide
2-fluoro-N'-methylpropanimidamide (PubChem CID 91141479) has the molecular formula C4H9FN2
and a molecular weight of 104.13 g/mol. Its IUPAC name is 2-fluoro-N'-methylpropanimidamide.
Molecular Properties
| Compound Name | 2-fluoro-N'-methylpropanimidamide |
| PubChem CID | 91141479 |
| Molecular Formula | C4H9FN2 |
| Molecular Weight | 104.13 g/mol |
| Exact Mass | 104.07 |
| IUPAC Name | 2-fluoro-N'-methylpropanimidamide |
| SMILES | C/N=C(\N)C(C)F |
| InChI | InChI=1S/C4H9FN2/c1-3(5)4(6)7-2/h3H,1-2H3,(H2,6,7) |
| InChIKey | FRFFHMZQSAUTNS-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 104.13 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-N'-methylpropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-N'-methylpropanimidamide?
The IUPAC name of 2-fluoro-N'-methylpropanimidamide (CID 91141479) is 2-fluoro-N'-methylpropanimidamide.
What is the SMILES notation for 2-fluoro-N'-methylpropanimidamide?
The canonical SMILES for 2-fluoro-N'-methylpropanimidamide is C/N=C(\N)C(C)F.
What is the InChIKey of 2-fluoro-N'-methylpropanimidamide?
The InChIKey is FRFFHMZQSAUTNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9FN2/c1-3(5)4(6)7-2/h3H,1-2H3,(H2,6,7).
What are the key properties of 2-fluoro-N'-methylpropanimidamide?
2-fluoro-N'-methylpropanimidamide has a molecular weight of 104.13 g/mol, XLogP of 0.33, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-N'-methylpropanimidamide is sourced from PubChem (CID 91141479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).