C12H11O3W- — CID 18728674
[(2Z)-4-(3,4-dioxo-2-propan-2-yloxycyclobuten-1-yl)penta-2,4-dienylidene]tungsten (PubChem CID 18728674) has the molecular formula C12H11O3W- and a molecular weight of 387.06 g/mol. Its IUPAC name is [(2Z)-4-(3,4-dioxo-2-propan-2-yloxycyclobuten-1-yl)penta-2,4-dienylidene]tungsten.
| Compound Name | [(2Z)-4-(3,4-dioxo-2-propan-2-yloxycyclobuten-1-yl)penta-2,4-dienylidene]tungsten |
|---|---|
| PubChem CID | 18728674 |
| Molecular Formula | C12H11O3W- |
| Molecular Weight | 387.06 g/mol |
| Exact Mass | 387.02 |
| IUPAC Name | [(2Z)-4-(3,4-dioxo-2-propan-2-yloxycyclobuten-1-yl)penta-2,4-dienylidene]tungsten |
| SMILES | [H]/[C-]=C(/C=C\C=[W])c1c(OC(C)C)c(=O)c1=O |
| InChI | InChI=1S/C12H11O3.W/c1-5-6-8(4)9-10(13)11(14)12(9)15-7(2)3;/h1,4-7H,2-3H3;/q-1;/b6-5-; |
| InChIKey | MRDNXJBRKJHEFM-YSMBQZINSA-N |
| XLogP | 0.79 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.06 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|