C16H22O3 — CID 10611512
3-propan-2-yloxy-4-[(Z)-2-prop-1-en-2-ylhex-1-enyl]cyclobut-3-ene-1,2-dione (PubChem CID 10611512) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is 3-propan-2-yloxy-4-[(Z)-2-prop-1-en-2-ylhex-1-enyl]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-propan-2-yloxy-4-[(Z)-2-prop-1-en-2-ylhex-1-enyl]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 10611512 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | 3-propan-2-yloxy-4-[(Z)-2-prop-1-en-2-ylhex-1-enyl]cyclobut-3-ene-1,2-dione |
| SMILES | C=C(C)/C(=C\c1c(OC(C)C)c(=O)c1=O)CCCC |
| InChI | InChI=1S/C16H22O3/c1-6-7-8-12(10(2)3)9-13-14(17)15(18)16(13)19-11(4)5/h9,11H,2,6-8H2,1,3-5H3/b12-9- |
| InChIKey | QJQGLVVBYQKQJH-XFXZXTDPSA-N |
| XLogP | 3.22 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|