C14H13O3W- — CID 18728678
[(2Z,5E)-6-(3,4-dioxo-2-propan-2-yloxycyclobuten-1-yl)-4-methanidylidenehexa-2,5-dienylidene]tungsten (PubChem CID 18728678) has the molecular formula C14H13O3W- and a molecular weight of 413.10 g/mol. Its IUPAC name is [(2Z,5E)-6-(3,4-dioxo-2-propan-2-yloxycyclobuten-1-yl)-4-methanidylidenehexa-2,5-dienylidene]tungsten.
| Compound Name | [(2Z,5E)-6-(3,4-dioxo-2-propan-2-yloxycyclobuten-1-yl)-4-methanidylidenehexa-2,5-dienylidene]tungsten |
|---|---|
| PubChem CID | 18728678 |
| Molecular Formula | C14H13O3W- |
| Molecular Weight | 413.10 g/mol |
| Exact Mass | 413.04 |
| IUPAC Name | [(2Z,5E)-6-(3,4-dioxo-2-propan-2-yloxycyclobuten-1-yl)-4-methanidylidenehexa-2,5-dienylidene]tungsten |
| SMILES | [H]/[C-]=C(/C=C\C=[W])\C=C\c1c(OC(C)C)c(=O)c1=O |
| InChI | InChI=1S/C14H13O3.W/c1-5-6-10(4)7-8-11-12(15)13(16)14(11)17-9(2)3;/h1,4-9H,2-3H3;/q-1;/b6-5-,8-7+; |
| InChIKey | CQRPTAIYSNLACS-DUZKJZLISA-N |
| XLogP | 1.35 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.10 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|