C12H15NOS2 — CID 18731843
6-methylspiro[1H-thieno[3,2-d][1,3]oxazine-4,1'-cyclohexane]-2-thione (PubChem CID 18731843) has the molecular formula C12H15NOS2 and a molecular weight of 253.39 g/mol. Its IUPAC name is 6-methylspiro[1H-thieno[3,2-d][1,3]oxazine-4,1'-cyclohexane]-2-thione.
| Compound Name | 6-methylspiro[1H-thieno[3,2-d][1,3]oxazine-4,1'-cyclohexane]-2-thione |
|---|---|
| PubChem CID | 18731843 |
| Molecular Formula | C12H15NOS2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | 6-methylspiro[1H-thieno[3,2-d][1,3]oxazine-4,1'-cyclohexane]-2-thione |
| SMILES | Cc1cc2c(s1)C1(CCCCC1)OC(=S)N2 |
| InChI | InChI=1S/C12H15NOS2/c1-8-7-9-10(16-8)12(14-11(15)13-9)5-3-2-4-6-12/h7H,2-6H2,1H3,(H,13,15) |
| InChIKey | XRMVYZXPAGVBAV-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|