C17H26BrNSSi — CID 57153350
[1-(5-bromo-1,3-dihydro-2,1-benzothiazol-3-yl)cyclohexyl]methyl-trimethylsilane (PubChem CID 57153350) has the molecular formula C17H26BrNSSi and a molecular weight of 384.46 g/mol. Its IUPAC name is [1-(5-bromo-1,3-dihydro-2,1-benzothiazol-3-yl)cyclohexyl]methyl-trimethylsilane.
| Compound Name | [1-(5-bromo-1,3-dihydro-2,1-benzothiazol-3-yl)cyclohexyl]methyl-trimethylsilane |
|---|---|
| PubChem CID | 57153350 |
| Molecular Formula | C17H26BrNSSi |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | [1-(5-bromo-1,3-dihydro-2,1-benzothiazol-3-yl)cyclohexyl]methyl-trimethylsilane |
| SMILES | C[Si](C)(C)CC1(C2SNc3ccc(Br)cc32)CCCCC1 |
| InChI | InChI=1S/C17H26BrNSSi/c1-21(2,3)12-17(9-5-4-6-10-17)16-14-11-13(18)7-8-15(14)19-20-16/h7-8,11,16,19H,4-6,9-10,12H2,1-3H3 |
| InChIKey | BRKOPGFELXNUFS-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|