C24H27ClFN3O — CID 18733719
N-[(6-chloro-1-cyclopentylbenzimidazol-2-yl)methyl]-2-fluoro-N-(2-methylpropyl)benzamide (PubChem CID 18733719) has the molecular formula C24H27ClFN3O and a molecular weight of 427.95 g/mol. Its IUPAC name is N-[(6-chloro-1-cyclopentylbenzimidazol-2-yl)methyl]-2-fluoro-N-(2-methylpropyl)benzamide.
| Compound Name | N-[(6-chloro-1-cyclopentylbenzimidazol-2-yl)methyl]-2-fluoro-N-(2-methylpropyl)benzamide |
|---|---|
| PubChem CID | 18733719 |
| Molecular Formula | C24H27ClFN3O |
| Molecular Weight | 427.95 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | N-[(6-chloro-1-cyclopentylbenzimidazol-2-yl)methyl]-2-fluoro-N-(2-methylpropyl)benzamide |
| SMILES | CC(C)CN(Cc1nc2ccc(Cl)cc2n1C1CCCC1)C(=O)c1ccccc1F |
| InChI | InChI=1S/C24H27ClFN3O/c1-16(2)14-28(24(30)19-9-5-6-10-20(19)26)15-23-27-21-12-11-17(25)13-22(21)29(23)18-7-3-4-8-18/h5-6,9-13,16,18H,3-4,7-8,14-15H2,1-2H3 |
| InChIKey | NPLMDUGOPLDCRZ-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.95 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |