C22H45NO — CID 18735616
N-heptan-4-yl-3,3-dimethyl-N-nonan-5-ylbutanamide (PubChem CID 18735616) has the molecular formula C22H45NO and a molecular weight of 339.61 g/mol. Its IUPAC name is N-heptan-4-yl-3,3-dimethyl-N-nonan-5-ylbutanamide.
| Compound Name | N-heptan-4-yl-3,3-dimethyl-N-nonan-5-ylbutanamide |
|---|---|
| PubChem CID | 18735616 |
| Molecular Formula | C22H45NO |
| Molecular Weight | 339.61 g/mol |
| Exact Mass | 339.35 |
| IUPAC Name | N-heptan-4-yl-3,3-dimethyl-N-nonan-5-ylbutanamide |
| SMILES | CCCCC(CCCC)N(C(=O)CC(C)(C)C)C(CCC)CCC |
| InChI | InChI=1S/C22H45NO/c1-8-12-16-20(17-13-9-2)23(19(14-10-3)15-11-4)21(24)18-22(5,6)7/h19-20H,8-18H2,1-7H3 |
| InChIKey | RTKFPEVGOADVHM-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.61 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |