C23H46N2O2 — CID 121263966
N-butyl-4-[3,3-dimethylbutanoyl(3-methylbutyl)amino]-2,2,4-trimethylpentanamide (PubChem CID 121263966) has the molecular formula C23H46N2O2 and a molecular weight of 382.63 g/mol. Its IUPAC name is N-butyl-4-[3,3-dimethylbutanoyl(3-methylbutyl)amino]-2,2,4-trimethylpentanamide.
| Compound Name | N-butyl-4-[3,3-dimethylbutanoyl(3-methylbutyl)amino]-2,2,4-trimethylpentanamide |
|---|---|
| PubChem CID | 121263966 |
| Molecular Formula | C23H46N2O2 |
| Molecular Weight | 382.63 g/mol |
| Exact Mass | 382.36 |
| IUPAC Name | N-butyl-4-[3,3-dimethylbutanoyl(3-methylbutyl)amino]-2,2,4-trimethylpentanamide |
| SMILES | CCCCNC(=O)C(C)(C)CC(C)(C)N(CCC(C)C)C(=O)CC(C)(C)C |
| InChI | InChI=1S/C23H46N2O2/c1-11-12-14-24-20(27)22(7,8)17-23(9,10)25(15-13-18(2)3)19(26)16-21(4,5)6/h18H,11-17H2,1-10H3,(H,24,27) |
| InChIKey | WXFOMSBTAVVODQ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.63 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|