C12H19NO2P2 — CID 18736713
diphosphanyl 3-(3,4-dimethylphenyl)-2-(methylamino)propanoate (PubChem CID 18736713) has the molecular formula C12H19NO2P2 and a molecular weight of 271.24 g/mol. Its IUPAC name is diphosphanyl 3-(3,4-dimethylphenyl)-2-(methylamino)propanoate.
| Compound Name | diphosphanyl 3-(3,4-dimethylphenyl)-2-(methylamino)propanoate |
|---|---|
| PubChem CID | 18736713 |
| Molecular Formula | C12H19NO2P2 |
| Molecular Weight | 271.24 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | diphosphanyl 3-(3,4-dimethylphenyl)-2-(methylamino)propanoate |
| SMILES | CNC(Cc1ccc(C)c(C)c1)C(=O)OPP |
| InChI | InChI=1S/C12H19NO2P2/c1-8-4-5-10(6-9(8)2)7-11(13-3)12(14)15-17-16/h4-6,11,13,17H,7,16H2,1-3H3 |
| InChIKey | VPXZFERYSUNYEB-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.24 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|