C13H20O3P2 — CID 158404827
diphosphanyl (2S)-2-[(4-hydroxy-3,5-dimethylphenyl)methyl]butanoate (PubChem CID 158404827) has the molecular formula C13H20O3P2 and a molecular weight of 286.25 g/mol. Its IUPAC name is diphosphanyl (2S)-2-[(4-hydroxy-3,5-dimethylphenyl)methyl]butanoate.
| Compound Name | diphosphanyl (2S)-2-[(4-hydroxy-3,5-dimethylphenyl)methyl]butanoate |
|---|---|
| PubChem CID | 158404827 |
| Molecular Formula | C13H20O3P2 |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | diphosphanyl (2S)-2-[(4-hydroxy-3,5-dimethylphenyl)methyl]butanoate |
| SMILES | CC[C@@H](Cc1cc(C)c(O)c(C)c1)C(=O)OPP |
| InChI | InChI=1S/C13H20O3P2/c1-4-11(13(15)16-18-17)7-10-5-8(2)12(14)9(3)6-10/h5-6,11,14,18H,4,7,17H2,1-3H3/t11-/m0/s1 |
| InChIKey | GYNXZRXACJPBGT-NSHDSACASA-N |
| XLogP | 3.50 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|