C13H20O3 — CID 102039369
4-(2-ethoxy-2-methoxyethyl)-2,6-dimethylphenol (PubChem CID 102039369) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is 4-(2-ethoxy-2-methoxyethyl)-2,6-dimethylphenol.
| Compound Name | 4-(2-ethoxy-2-methoxyethyl)-2,6-dimethylphenol |
|---|---|
| PubChem CID | 102039369 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | 4-(2-ethoxy-2-methoxyethyl)-2,6-dimethylphenol |
| SMILES | CCOC(Cc1cc(C)c(O)c(C)c1)OC |
| InChI | InChI=1S/C13H20O3/c1-5-16-12(15-4)8-11-6-9(2)13(14)10(3)7-11/h6-7,12,14H,5,8H2,1-4H3 |
| InChIKey | DSBIPHIECJACGN-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|