C33H58N4O4 — CID 18737945
(10,13-dimethyl-17-propan-2-yl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl) N-[1-[4-aminobutyl(3-aminopropyl)amino]-3-hydroxy-1-oxopropan-2-yl]carbamate (PubChem CID 18737945) has the molecular formula C33H58N4O4 and a molecular weight of 574.85 g/mol. Its IUPAC name is (10,13-dimethyl-17-propan-2-yl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl) N-[1-[4-aminobutyl(3-aminopropyl)amino]-3-hydroxy-1-oxopropan-2-yl]carbamate.
| Compound Name | (10,13-dimethyl-17-propan-2-yl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl) N-[1-[4-aminobutyl(3-aminopropyl)amino]-3-hydroxy-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18737945 |
| Molecular Formula | C33H58N4O4 |
| Molecular Weight | 574.85 g/mol |
| Exact Mass | 574.45 |
| IUPAC Name | (10,13-dimethyl-17-propan-2-yl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl) N-[1-[4-aminobutyl(3-aminopropyl)amino]-3-hydroxy-1-oxopropan-2-yl]carbamate |
| SMILES | CC(C)C1CCC2C3CC=C4CC(OC(=O)NC(CO)C(=O)N(CCCN)CCCCN)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C33H58N4O4/c1-22(2)26-10-11-27-25-9-8-23-20-24(12-14-32(23,3)28(25)13-15-33(26,27)4)41-31(40)36-29(21-38)30(39)37(19-7-17-35)18-6-5-16-34/h8,22,24-29,38H,5-7,9-21,34-35H2,1-4H3,(H,36,40) |
| InChIKey | QVAIIALXGRHUJY-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 130.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.85 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|