C28H37N3O4 — CID 18738252
2,3-dihydro-1H-inden-5-yl (2S)-2-[[[(3R)-1-(3-piperidin-4-ylpropanoyl)piperidine-3-carbonyl]amino]methyl]but-3-ynoate (PubChem CID 18738252) has the molecular formula C28H37N3O4 and a molecular weight of 479.62 g/mol. Its IUPAC name is 2,3-dihydro-1H-inden-5-yl (2S)-2-[[[(3R)-1-(3-piperidin-4-ylpropanoyl)piperidine-3-carbonyl]amino]methyl]but-3-ynoate.
| Compound Name | 2,3-dihydro-1H-inden-5-yl (2S)-2-[[[(3R)-1-(3-piperidin-4-ylpropanoyl)piperidine-3-carbonyl]amino]methyl]but-3-ynoate |
|---|---|
| PubChem CID | 18738252 |
| Molecular Formula | C28H37N3O4 |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.28 |
| IUPAC Name | 2,3-dihydro-1H-inden-5-yl (2S)-2-[[[(3R)-1-(3-piperidin-4-ylpropanoyl)piperidine-3-carbonyl]amino]methyl]but-3-ynoate |
| SMILES | C#C[C@@H](CNC(=O)[C@@H]1CCCN(C(=O)CCC2CCNCC2)C1)C(=O)Oc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C28H37N3O4/c1-2-21(28(34)35-25-10-9-22-5-3-6-23(22)17-25)18-30-27(33)24-7-4-16-31(19-24)26(32)11-8-20-12-14-29-15-13-20/h1,9-10,17,20-21,24,29H,3-8,11-16,18-19H2,(H,30,33)/t21-,24+/m0/s1 |
| InChIKey | XWPARHBHGZIEKR-XUZZJYLKSA-N |
| XLogP | 2.46 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|