C22H42N6O8 — CID 18740643
2-[4-[2-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]ethyl]-7-(2-hydroperoxyethyl)-1,4,7-triazonan-1-yl]acetic acid (PubChem CID 18740643) has the molecular formula C22H42N6O8 and a molecular weight of 518.61 g/mol. Its IUPAC name is 2-[4-[2-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]ethyl]-7-(2-hydroperoxyethyl)-1,4,7-triazonan-1-yl]acetic acid.
| Compound Name | 2-[4-[2-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]ethyl]-7-(2-hydroperoxyethyl)-1,4,7-triazonan-1-yl]acetic acid |
|---|---|
| PubChem CID | 18740643 |
| Molecular Formula | C22H42N6O8 |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.31 |
| IUPAC Name | 2-[4-[2-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]ethyl]-7-(2-hydroperoxyethyl)-1,4,7-triazonan-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCN(CCOO)CCN(CCN2CCN(CC(=O)O)CCN(CC(=O)O)CC2)CC1 |
| InChI | InChI=1S/C22H42N6O8/c29-20(30)17-26-9-5-23(3-4-25(8-12-26)15-16-36-35)1-2-24-6-10-27(18-21(31)32)13-14-28(11-7-24)19-22(33)34/h35H,1-19H2,(H,29,30)(H,31,32)(H,33,34) |
| InChIKey | LRXCPCHLRLSUJR-UHFFFAOYSA-N |
| XLogP | -2.43 |
| TPSA | 160.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | -2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|