C11H15NS — CID 18740924
2-ethyl-N-methyl-2,3-dihydro-1-benzothiophen-5-amine (PubChem CID 18740924) has the molecular formula C11H15NS and a molecular weight of 193.31 g/mol. Its IUPAC name is 2-ethyl-N-methyl-2,3-dihydro-1-benzothiophen-5-amine.
| Compound Name | 2-ethyl-N-methyl-2,3-dihydro-1-benzothiophen-5-amine |
|---|---|
| PubChem CID | 18740924 |
| Molecular Formula | C11H15NS |
| Molecular Weight | 193.31 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 2-ethyl-N-methyl-2,3-dihydro-1-benzothiophen-5-amine |
| SMILES | CCC1Cc2cc(NC)ccc2S1 |
| InChI | InChI=1S/C11H15NS/c1-3-10-7-8-6-9(12-2)4-5-11(8)13-10/h4-6,10,12H,3,7H2,1-2H3 |
| InChIKey | COLCZABSODEHTC-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.31 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |